C35H37NO8 — CID 7910033
2-phenoxyethyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate (PubChem CID 7910033) has the molecular formula C35H37NO8 and a molecular weight of 599.68 g/mol. Its IUPAC name is 2-phenoxyethyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate.
| Compound Name | 2-phenoxyethyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7910033 |
| Molecular Formula | C35H37NO8 |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | 2-phenoxyethyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate |
| SMILES | CCOc1cc([C@@H]2C(C(=O)OCCOc3ccccc3)=C(C)N=C3C[C@@H](c4ccc(OC)c(OC)c4)CC(=O)C32)ccc1O |
| InChI | InChI=1S/C35H37NO8/c1-5-42-30-20-23(11-13-27(30)37)33-32(35(39)44-16-15-43-25-9-7-6-8-10-25)21(2)36-26-17-24(18-28(38)34(26)33)22-12-14-29(40-3)31(19-22)41-4/h6-14,19-20,24,33-34,37H,5,15-18H2,1-4H3/t24-,33-,34?/m1/s1 |
| InChIKey | CRTMDYCCEXWYQX-YGCJXZOVSA-N |
| XLogP | 6.01 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|