C28H31NO6 — CID 7910108
methyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate (PubChem CID 7910108) has the molecular formula C28H31NO6 and a molecular weight of 477.56 g/mol. Its IUPAC name is methyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate.
| Compound Name | methyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7910108 |
| Molecular Formula | C28H31NO6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | methyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxyphenyl)-2-methyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3-carboxylate |
| SMILES | CCOc1cccc([C@H]2C(C(=O)OC)=C(C)N=C3C[C@H](c4ccc(OC)c(OC)c4)CC(=O)C32)c1 |
| InChI | InChI=1S/C28H31NO6/c1-6-35-20-9-7-8-18(12-20)26-25(28(31)34-5)16(2)29-21-13-19(14-22(30)27(21)26)17-10-11-23(32-3)24(15-17)33-4/h7-12,15,19,26-27H,6,13-14H2,1-5H3/t19-,26-,27?/m0/s1 |
| InChIKey | VVXHJALVJCWEOB-RZUYQHNOSA-N |
| XLogP | 4.85 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |