C22H35N2O2+ — CID 6964229
N-benzyl-1-(cyclohexylmethyl)-N-(2-hydroxyethyl)piperidin-1-ium-4-carboxamide (PubChem CID 6964229) has the molecular formula C22H35N2O2+ and a molecular weight of 359.53 g/mol. Its IUPAC name is N-benzyl-1-(cyclohexylmethyl)-N-(2-hydroxyethyl)piperidin-1-ium-4-carboxamide.
| Compound Name | N-benzyl-1-(cyclohexylmethyl)-N-(2-hydroxyethyl)piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 6964229 |
| Molecular Formula | C22H35N2O2+ |
| Molecular Weight | 359.53 g/mol |
| Exact Mass | 359.27 |
| IUPAC Name | N-benzyl-1-(cyclohexylmethyl)-N-(2-hydroxyethyl)piperidin-1-ium-4-carboxamide |
| SMILES | O=C(C1CC[NH+](CC2CCCCC2)CC1)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C22H34N2O2/c25-16-15-24(18-20-9-5-2-6-10-20)22(26)21-11-13-23(14-12-21)17-19-7-3-1-4-8-19/h2,5-6,9-10,19,21,25H,1,3-4,7-8,11-18H2/p+1 |
| InChIKey | RPOMVRBWEKXBIK-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 44.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.53 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |