C25H37N3O3 — CID 60619843
N-(3-amino-3-oxopropyl)-N-benzyl-4-[(2-cyclohexylacetyl)amino]cyclohexane-1-carboxamide (PubChem CID 60619843) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-N-benzyl-4-[(2-cyclohexylacetyl)amino]cyclohexane-1-carboxamide.
| Compound Name | N-(3-amino-3-oxopropyl)-N-benzyl-4-[(2-cyclohexylacetyl)amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 60619843 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-N-benzyl-4-[(2-cyclohexylacetyl)amino]cyclohexane-1-carboxamide |
| SMILES | NC(=O)CCN(Cc1ccccc1)C(=O)C1CCC(NC(=O)CC2CCCCC2)CC1 |
| InChI | InChI=1S/C25H37N3O3/c26-23(29)15-16-28(18-20-9-5-2-6-10-20)25(31)21-11-13-22(14-12-21)27-24(30)17-19-7-3-1-4-8-19/h2,5-6,9-10,19,21-22H,1,3-4,7-8,11-18H2,(H2,26,29)(H,27,30) |
| InChIKey | ZSLYLWVMCRFXFN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |