C22H27NO4S — CID 6964666
[(2S)-oxolan-2-yl]methyl (4R)-2,7,7-trimethyl-5-oxo-4-thiophen-3-yl-3,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 6964666) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl (4R)-2,7,7-trimethyl-5-oxo-4-thiophen-3-yl-3,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | [(2S)-oxolan-2-yl]methyl (4R)-2,7,7-trimethyl-5-oxo-4-thiophen-3-yl-3,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 6964666 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl (4R)-2,7,7-trimethyl-5-oxo-4-thiophen-3-yl-3,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CC1=NC2=C(C(=O)CC(C)(C)C2)[C@H](c2ccsc2)C1C(=O)OC[C@@H]1CCCO1 |
| InChI | InChI=1S/C22H27NO4S/c1-13-18(21(25)27-11-15-5-4-7-26-15)19(14-6-8-28-12-14)20-16(23-13)9-22(2,3)10-17(20)24/h6,8,12,15,18-19H,4-5,7,9-11H2,1-3H3/t15-,18?,19+/m0/s1 |
| InChIKey | HDBYMOYVAXOYMK-JMRRQPBMSA-N |
| XLogP | 4.29 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |