C24H29NO4 — CID 7409497
[(2R)-oxolan-2-yl]methyl (4R)-2,7,7-trimethyl-5-oxo-4-phenyl-3,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 7409497) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl (4R)-2,7,7-trimethyl-5-oxo-4-phenyl-3,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | [(2R)-oxolan-2-yl]methyl (4R)-2,7,7-trimethyl-5-oxo-4-phenyl-3,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 7409497 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl (4R)-2,7,7-trimethyl-5-oxo-4-phenyl-3,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CC1=NC2=C(C(=O)CC(C)(C)C2)[C@@H](c2ccccc2)C1C(=O)OC[C@H]1CCCO1 |
| InChI | InChI=1S/C24H29NO4/c1-15-20(23(27)29-14-17-10-7-11-28-17)21(16-8-5-4-6-9-16)22-18(25-15)12-24(2,3)13-19(22)26/h4-6,8-9,17,20-21H,7,10-14H2,1-3H3/t17-,20?,21+/m1/s1 |
| InChIKey | CDPGHMJGXLVWAY-LYHOZKKVSA-N |
| XLogP | 4.23 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |