C20H16N5S+ — CID 6966118
2-amino-6-(2-aminophenyl)sulfanyl-4-(4-methylphenyl)pyridin-1-ium-3,5-dicarbonitrile (PubChem CID 6966118) has the molecular formula C20H16N5S+ and a molecular weight of 358.45 g/mol. Its IUPAC name is 2-amino-6-(2-aminophenyl)sulfanyl-4-(4-methylphenyl)pyridin-1-ium-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-(2-aminophenyl)sulfanyl-4-(4-methylphenyl)pyridin-1-ium-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 6966118 |
| Molecular Formula | C20H16N5S+ |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-amino-6-(2-aminophenyl)sulfanyl-4-(4-methylphenyl)pyridin-1-ium-3,5-dicarbonitrile |
| SMILES | Cc1ccc(-c2c(C#N)c(N)[nH+]c(Sc3ccccc3N)c2C#N)cc1 |
| InChI | InChI=1S/C20H15N5S/c1-12-6-8-13(9-7-12)18-14(10-21)19(24)25-20(15(18)11-22)26-17-5-3-2-4-16(17)23/h2-9H,23H2,1H3,(H2,24,25)/p+1 |
| InChIKey | WKNGKISTSCJIGF-UHFFFAOYSA-O |
| XLogP | 3.54 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_amino_het_B(1)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|