C12H17N4O3+ — CID 6967415
5',7'-dimethylspiro[cyclohexane-1,3'-pyrimido[5,4-c][1,2,5]oxadiazin-4-ium]-6',8'-dione (PubChem CID 6967415) has the molecular formula C12H17N4O3+ and a molecular weight of 265.29 g/mol. Its IUPAC name is 5',7'-dimethylspiro[cyclohexane-1,3'-pyrimido[5,4-c][1,2,5]oxadiazin-4-ium]-6',8'-dione.
| Compound Name | 5',7'-dimethylspiro[cyclohexane-1,3'-pyrimido[5,4-c][1,2,5]oxadiazin-4-ium]-6',8'-dione |
|---|---|
| PubChem CID | 6967415 |
| Molecular Formula | C12H17N4O3+ |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 5',7'-dimethylspiro[cyclohexane-1,3'-pyrimido[5,4-c][1,2,5]oxadiazin-4-ium]-6',8'-dione |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)=[NH+]C1(CCCCC1)ON=2 |
| InChI | InChI=1S/C12H16N4O3/c1-15-9-8(10(17)16(2)11(15)18)14-19-12(13-9)6-4-3-5-7-12/h3-7H2,1-2H3/p+1 |
| InChIKey | GXETZCPEKGYDMN-UHFFFAOYSA-O |
| XLogP | -2.99 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |