C12H17N4O2+ — CID 6940495
1',3'-dimethylspiro[cyclohexane-1,8'-purin-9-ium]-2',6'-dione (PubChem CID 6940495) has the molecular formula C12H17N4O2+ and a molecular weight of 249.29 g/mol. Its IUPAC name is 1',3'-dimethylspiro[cyclohexane-1,8'-purin-9-ium]-2',6'-dione.
| Compound Name | 1',3'-dimethylspiro[cyclohexane-1,8'-purin-9-ium]-2',6'-dione |
|---|---|
| PubChem CID | 6940495 |
| Molecular Formula | C12H17N4O2+ |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 1',3'-dimethylspiro[cyclohexane-1,8'-purin-9-ium]-2',6'-dione |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)=[NH+]C1(CCCCC1)N=2 |
| InChI | InChI=1S/C12H16N4O2/c1-15-9-8(10(17)16(2)11(15)18)13-12(14-9)6-4-3-5-7-12/h3-7H2,1-2H3/p+1 |
| InChIKey | TWIOWKHTTGCXPK-UHFFFAOYSA-O |
| XLogP | -2.92 |
| TPSA | 70.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |