C15H24N6O2 — CID 150192833
8-(4-amino-4-piperidin-1-ylbutyl)-8-methyl-3H-purine-2,6-dione (PubChem CID 150192833) has the molecular formula C15H24N6O2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 8-(4-amino-4-piperidin-1-ylbutyl)-8-methyl-3H-purine-2,6-dione.
| Compound Name | 8-(4-amino-4-piperidin-1-ylbutyl)-8-methyl-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 150192833 |
| Molecular Formula | C15H24N6O2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 8-(4-amino-4-piperidin-1-ylbutyl)-8-methyl-3H-purine-2,6-dione |
| SMILES | CC1(CCCC(N)N2CCCCC2)N=c2[nH]c(=O)[nH]c(=O)c2=N1 |
| InChI | InChI=1S/C15H24N6O2/c1-15(7-5-6-10(16)21-8-3-2-4-9-21)19-11-12(20-15)17-14(23)18-13(11)22/h10H,2-9,16H2,1H3,(H2,17,18,20,22,23) |
| InChIKey | FNUNXLOFXBZNPC-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 119.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |