C12H16N5O2+ — CID 78175543
1,3-dimethyl-8-piperidin-1-ium-1-ylidenepurine-2,6-dione (PubChem CID 78175543) has the molecular formula C12H16N5O2+ and a molecular weight of 262.29 g/mol. Its IUPAC name is 1,3-dimethyl-8-piperidin-1-ium-1-ylidenepurine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-piperidin-1-ium-1-ylidenepurine-2,6-dione |
|---|---|
| PubChem CID | 78175543 |
| Molecular Formula | C12H16N5O2+ |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1,3-dimethyl-8-piperidin-1-ium-1-ylidenepurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)=NC(=[N+]1CCCCC1)N=2 |
| InChI | InChI=1S/C12H16N5O2/c1-15-9-8(10(18)16(2)12(15)19)13-11(14-9)17-6-4-3-5-7-17/h3-7H2,1-2H3/q+1 |
| InChIKey | NYZOIDSVMJUZIT-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 71.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|