C15H23N6O3+ — CID 78208138
2-[1,3-dimethyl-2,6-dioxo-8-(piperidin-1-ylmethyl)-5H-purin-7-ium-7-yl]acetamide (PubChem CID 78208138) has the molecular formula C15H23N6O3+ and a molecular weight of 335.39 g/mol. Its IUPAC name is 2-[1,3-dimethyl-2,6-dioxo-8-(piperidin-1-ylmethyl)-5H-purin-7-ium-7-yl]acetamide.
| Compound Name | 2-[1,3-dimethyl-2,6-dioxo-8-(piperidin-1-ylmethyl)-5H-purin-7-ium-7-yl]acetamide |
|---|---|
| PubChem CID | 78208138 |
| Molecular Formula | C15H23N6O3+ |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-[1,3-dimethyl-2,6-dioxo-8-(piperidin-1-ylmethyl)-5H-purin-7-ium-7-yl]acetamide |
| SMILES | CN1C(=O)C2C(=NC(CN3CCCCC3)=[N+]2CC(N)=O)N(C)C1=O |
| InChI | InChI=1S/C15H22N6O3/c1-18-13-12(14(23)19(2)15(18)24)21(8-10(16)22)11(17-13)9-20-6-4-3-5-7-20/h12H,3-9H2,1-2H3,(H-,16,22)/p+1 |
| InChIKey | BFJXSTQEIUOUKH-UHFFFAOYSA-O |
| XLogP | -1.33 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|