C13H18N5O2+ — CID 75094333
cyclohexyl-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)azanium (PubChem CID 75094333) has the molecular formula C13H18N5O2+ and a molecular weight of 276.32 g/mol. Its IUPAC name is cyclohexyl-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)azanium.
| Compound Name | cyclohexyl-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)azanium |
|---|---|
| PubChem CID | 75094333 |
| Molecular Formula | C13H18N5O2+ |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | cyclohexyl-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)azanium |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)=N/C(=[NH+]/C1CCCCC1)N=2 |
| InChI | InChI=1S/C13H17N5O2/c1-17-10-9(11(19)18(2)13(17)20)15-12(16-10)14-8-6-4-3-5-7-8/h8H,3-7H2,1-2H3/p+1/b14-12+ |
| InChIKey | JJAIZZBBNJEWPU-WYMLVPIESA-O |
| XLogP | -2.89 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|