C15H22N5O3+ — CID 74699757
N-cyclohexyl-2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)acetamide (PubChem CID 74699757) has the molecular formula C15H22N5O3+ and a molecular weight of 320.37 g/mol. Its IUPAC name is N-cyclohexyl-2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)acetamide.
| Compound Name | N-cyclohexyl-2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 74699757 |
| Molecular Formula | C15H22N5O3+ |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-cyclohexyl-2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)acetamide |
| SMILES | CN1C(=O)N(CC(=O)NC2CCCCC2)C(=O)C2C1=NC=[N+]2C |
| InChI | InChI=1S/C15H21N5O3/c1-18-9-16-13-12(18)14(22)20(15(23)19(13)2)8-11(21)17-10-6-4-3-5-7-10/h9-10,12H,3-8H2,1-2H3/p+1 |
| InChIKey | ZWMXLKZSDSOORV-UHFFFAOYSA-O |
| XLogP | -0.22 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|