C11H16N5O2+ — CID 73328648
(1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(2-methylpropyl)azanium (PubChem CID 73328648) has the molecular formula C11H16N5O2+ and a molecular weight of 250.28 g/mol. Its IUPAC name is (1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(2-methylpropyl)azanium.
| Compound Name | (1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(2-methylpropyl)azanium |
|---|---|
| PubChem CID | 73328648 |
| Molecular Formula | C11H16N5O2+ |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | (1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(2-methylpropyl)azanium |
| SMILES | CC(C)C/[NH+]=C1\N=c2c(=O)n(C)c(=O)n(C)c2=N1 |
| InChI | InChI=1S/C11H15N5O2/c1-6(2)5-12-10-13-7-8(14-10)15(3)11(18)16(4)9(7)17/h6H,5H2,1-4H3/p+1/b12-10+ |
| InChIKey | KDDFINULMQYJDT-ZRDIBKRKSA-O |
| XLogP | -3.57 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|