C11H16N5O2+ — CID 78175516
butyl-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)azanium (PubChem CID 78175516) has the molecular formula C11H16N5O2+ and a molecular weight of 250.28 g/mol. Its IUPAC name is butyl-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)azanium.
| Compound Name | butyl-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)azanium |
|---|---|
| PubChem CID | 78175516 |
| Molecular Formula | C11H16N5O2+ |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | butyl-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)azanium |
| SMILES | CCCC/[NH+]=C1\N=c2c(=O)n(C)c(=O)n(C)c2=N1 |
| InChI | InChI=1S/C11H15N5O2/c1-4-5-6-12-10-13-7-8(14-10)15(2)11(18)16(3)9(7)17/h4-6H2,1-3H3/p+1/b12-10+ |
| InChIKey | BOIUWYYUQTWLJW-ZRDIBKRKSA-O |
| XLogP | -3.43 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|