C19H20N2O5 — CID 6967475
2-[[(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]benzamide (PubChem CID 6967475) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-[[(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]benzamide.
| Compound Name | 2-[[(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 6967475 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-[[(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]benzamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/C(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C19H20N2O5/c1-24-15-11-17(26-3)16(25-2)10-12(15)8-9-18(22)21-14-7-5-4-6-13(14)19(20)23/h4-11H,1-3H3,(H2,20,23)(H,21,22)/b9-8+ |
| InChIKey | DCQRIQIVFCWSNW-CMDGGOBGSA-N |
| XLogP | 2.46 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|