C19H16NO2- — CID 6975057
2-(4-ethylphenyl)-8-methylquinoline-4-carboxylate (PubChem CID 6975057) has the molecular formula C19H16NO2- and a molecular weight of 290.34 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-8-methylquinoline-4-carboxylate.
| Compound Name | 2-(4-ethylphenyl)-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 6975057 |
| Molecular Formula | C19H16NO2- |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-(4-ethylphenyl)-8-methylquinoline-4-carboxylate |
| SMILES | CCc1ccc(-c2cc(C(=O)[O-])c3cccc(C)c3n2)cc1 |
| InChI | InChI=1S/C19H17NO2/c1-3-13-7-9-14(10-8-13)17-11-16(19(21)22)15-6-4-5-12(2)18(15)20-17/h4-11H,3H2,1-2H3,(H,21,22)/p-1 |
| InChIKey | RECUOGALSOTYHL-UHFFFAOYSA-M |
| XLogP | 3.14 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |