C17H17NO3S — CID 697647
benzyl (2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 697647) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is benzyl (2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 697647 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | benzyl (2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1CCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C17H17NO3S/c19-16(15-9-5-11-22-15)18-10-4-8-14(18)17(20)21-12-13-6-2-1-3-7-13/h1-3,5-7,9,11,14H,4,8,10,12H2/t14-/m0/s1 |
| InChIKey | BBHSFCJBRGSXFO-AWEZNQCLSA-N |
| XLogP | 3.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |