C13H14Cl3NO4 — CID 6976953
ethyl (2R)-2-[2-chloro-4-[(2,2-dichloroacetyl)amino]phenoxy]propanoate (PubChem CID 6976953) has the molecular formula C13H14Cl3NO4 and a molecular weight of 354.62 g/mol. Its IUPAC name is ethyl (2R)-2-[2-chloro-4-[(2,2-dichloroacetyl)amino]phenoxy]propanoate.
| Compound Name | ethyl (2R)-2-[2-chloro-4-[(2,2-dichloroacetyl)amino]phenoxy]propanoate |
|---|---|
| PubChem CID | 6976953 |
| Molecular Formula | C13H14Cl3NO4 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | ethyl (2R)-2-[2-chloro-4-[(2,2-dichloroacetyl)amino]phenoxy]propanoate |
| SMILES | CCOC(=O)[C@@H](C)Oc1ccc(NC(=O)C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl3NO4/c1-3-20-13(19)7(2)21-10-5-4-8(6-9(10)14)17-12(18)11(15)16/h4-7,11H,3H2,1-2H3,(H,17,18)/t7-/m1/s1 |
| InChIKey | LZJUEZLFBYMUDW-SSDOTTSWSA-N |
| XLogP | 3.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|