C18H21BrN2O — CID 6977786
(1S)-N-[(E)-1-(3-bromophenyl)ethylideneamino]-2,2-dicyclopropylcyclopropane-1-carboxamide (PubChem CID 6977786) has the molecular formula C18H21BrN2O and a molecular weight of 361.28 g/mol. Its IUPAC name is (1S)-N-[(E)-1-(3-bromophenyl)ethylideneamino]-2,2-dicyclopropylcyclopropane-1-carboxamide.
| Compound Name | (1S)-N-[(E)-1-(3-bromophenyl)ethylideneamino]-2,2-dicyclopropylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 6977786 |
| Molecular Formula | C18H21BrN2O |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (1S)-N-[(E)-1-(3-bromophenyl)ethylideneamino]-2,2-dicyclopropylcyclopropane-1-carboxamide |
| SMILES | C/C(=N\NC(=O)[C@H]1CC1(C1CC1)C1CC1)c1cccc(Br)c1 |
| InChI | InChI=1S/C18H21BrN2O/c1-11(12-3-2-4-15(19)9-12)20-21-17(22)16-10-18(16,13-5-6-13)14-7-8-14/h2-4,9,13-14,16H,5-8,10H2,1H3,(H,21,22)/b20-11+/t16-/m1/s1 |
| InChIKey | APKXLSUWNNFIIN-MBTVCVBTSA-N |
| XLogP | 4.12 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|