C17H25N2O2+ — CID 6977914
[4-[(4-methylphenyl)methyl]piperazin-4-ium-1-yl]-[(2S)-oxolan-2-yl]methanone (PubChem CID 6977914) has the molecular formula C17H25N2O2+ and a molecular weight of 289.40 g/mol. Its IUPAC name is [4-[(4-methylphenyl)methyl]piperazin-4-ium-1-yl]-[(2S)-oxolan-2-yl]methanone.
| Compound Name | [4-[(4-methylphenyl)methyl]piperazin-4-ium-1-yl]-[(2S)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 6977914 |
| Molecular Formula | C17H25N2O2+ |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | [4-[(4-methylphenyl)methyl]piperazin-4-ium-1-yl]-[(2S)-oxolan-2-yl]methanone |
| SMILES | Cc1ccc(C[NH+]2CCN(C(=O)[C@@H]3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C17H24N2O2/c1-14-4-6-15(7-5-14)13-18-8-10-19(11-9-18)17(20)16-3-2-12-21-16/h4-7,16H,2-3,8-13H2,1H3/p+1/t16-/m0/s1 |
| InChIKey | FDKTWPDSEGJALZ-INIZCTEOSA-O |
| XLogP | 0.40 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |