C18H14BrN3O3S — CID 6978006
2-[(2Z,5R)-2-[(Z)-(4-bromophenyl)methylidenehydrazinylidene]-4-oxo-3-phenyl-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 6978006) has the molecular formula C18H14BrN3O3S and a molecular weight of 432.30 g/mol. Its IUPAC name is 2-[(2Z,5R)-2-[(Z)-(4-bromophenyl)methylidenehydrazinylidene]-4-oxo-3-phenyl-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(2Z,5R)-2-[(Z)-(4-bromophenyl)methylidenehydrazinylidene]-4-oxo-3-phenyl-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 6978006 |
| Molecular Formula | C18H14BrN3O3S |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | 2-[(2Z,5R)-2-[(Z)-(4-bromophenyl)methylidenehydrazinylidene]-4-oxo-3-phenyl-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1S/C(=N\N=C/c2ccc(Br)cc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H14BrN3O3S/c19-13-8-6-12(7-9-13)11-20-21-18-22(14-4-2-1-3-5-14)17(25)15(26-18)10-16(23)24/h1-9,11,15H,10H2,(H,23,24)/b20-11-,21-18-/t15-/m1/s1 |
| InChIKey | TUYSAMYDJRRLGP-LPGVVPLKSA-N |
| XLogP | 3.76 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|