C20H21N2O4- — CID 6978042
3-[[3-(2-ethylbutanoylamino)benzoyl]amino]benzoate (PubChem CID 6978042) has the molecular formula C20H21N2O4- and a molecular weight of 353.40 g/mol. Its IUPAC name is 3-[[3-(2-ethylbutanoylamino)benzoyl]amino]benzoate.
| Compound Name | 3-[[3-(2-ethylbutanoylamino)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 6978042 |
| Molecular Formula | C20H21N2O4- |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 3-[[3-(2-ethylbutanoylamino)benzoyl]amino]benzoate |
| SMILES | CCC(CC)C(=O)Nc1cccc(C(=O)Nc2cccc(C(=O)[O-])c2)c1 |
| InChI | InChI=1S/C20H22N2O4/c1-3-13(4-2)18(23)21-16-9-5-7-14(11-16)19(24)22-17-10-6-8-15(12-17)20(25)26/h5-13H,3-4H2,1-2H3,(H,21,23)(H,22,24)(H,25,26)/p-1 |
| InChIKey | JYEDIODOWULBCO-UHFFFAOYSA-M |
| XLogP | 2.68 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |