C15H20N3O4S+ — CID 6978297
(3R)-3-[4-(4-methylsulfonylphenyl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione (PubChem CID 6978297) has the molecular formula C15H20N3O4S+ and a molecular weight of 338.41 g/mol. Its IUPAC name is (3R)-3-[4-(4-methylsulfonylphenyl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(4-methylsulfonylphenyl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6978297 |
| Molecular Formula | C15H20N3O4S+ |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (3R)-3-[4-(4-methylsulfonylphenyl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione |
| SMILES | CS(=O)(=O)c1ccc(N2CC[NH+]([C@@H]3CC(=O)NC3=O)CC2)cc1 |
| InChI | InChI=1S/C15H19N3O4S/c1-23(21,22)12-4-2-11(3-5-12)17-6-8-18(9-7-17)13-10-14(19)16-15(13)20/h2-5,13H,6-10H2,1H3,(H,16,19,20)/p+1/t13-/m1/s1 |
| InChIKey | XDLBZEJMMGXJNB-CYBMUJFWSA-O |
| XLogP | -1.79 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|