C11H11ClF3NO2S — CID 697852
1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpyrrolidine (PubChem CID 697852) has the molecular formula C11H11ClF3NO2S and a molecular weight of 313.73 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpyrrolidine.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpyrrolidine |
|---|---|
| PubChem CID | 697852 |
| Molecular Formula | C11H11ClF3NO2S |
| Molecular Weight | 313.73 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpyrrolidine |
| SMILES | O=S(=O)(c1ccc(Cl)c(C(F)(F)F)c1)N1CCCC1 |
| InChI | InChI=1S/C11H11ClF3NO2S/c12-10-4-3-8(7-9(10)11(13,14)15)19(17,18)16-5-1-2-6-16/h3-4,7H,1-2,5-6H2 |
| InChIKey | JVGSEVZDIMISRV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.73 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |