C21H25N2O4+ — CID 6981157
2-[(2R)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(5-methylfuran-2-yl)-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium (PubChem CID 6981157) has the molecular formula C21H25N2O4+ and a molecular weight of 369.44 g/mol. Its IUPAC name is 2-[(2R)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(5-methylfuran-2-yl)-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium.
| Compound Name | 2-[(2R)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(5-methylfuran-2-yl)-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 6981157 |
| Molecular Formula | C21H25N2O4+ |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-[(2R)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(5-methylfuran-2-yl)-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium |
| SMILES | Cc1ccc(C(O)=C2C(=O)C(=O)N(CC[NH+](C)C)[C@H]2c2ccc(C)o2)cc1 |
| InChI | InChI=1S/C21H24N2O4/c1-13-5-8-15(9-6-13)19(24)17-18(16-10-7-14(2)27-16)23(12-11-22(3)4)21(26)20(17)25/h5-10,18,24H,11-12H2,1-4H3/p+1/t18-/m0/s1 |
| InChIKey | BUINGMMZDZOTBR-SFHVURJKSA-O |
| XLogP | 1.46 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|