C23H27N2O5+ — CID 7562434
2-[(2R)-3-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-2-(5-methylfuran-2-yl)-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium (PubChem CID 7562434) has the molecular formula C23H27N2O5+ and a molecular weight of 411.48 g/mol. Its IUPAC name is 2-[(2R)-3-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-2-(5-methylfuran-2-yl)-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium.
| Compound Name | 2-[(2R)-3-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-2-(5-methylfuran-2-yl)-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7562434 |
| Molecular Formula | C23H27N2O5+ |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2-[(2R)-3-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-2-(5-methylfuran-2-yl)-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium |
| SMILES | Cc1ccc([C@H]2C(=C(O)c3ccc4c(c3)C[C@H](C)O4)C(=O)C(=O)N2CC[NH+](C)C)o1 |
| InChI | InChI=1S/C23H26N2O5/c1-13-5-7-18(29-13)20-19(22(27)23(28)25(20)10-9-24(3)4)21(26)15-6-8-17-16(12-15)11-14(2)30-17/h5-8,12,14,20,26H,9-11H2,1-4H3/p+1/t14-,20-/m0/s1 |
| InChIKey | CHMSLHYHVMBALW-XOBRGWDASA-O |
| XLogP | 1.48 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|