C24H29N2O4S+ — CID 6959669
diethyl-[2-[(5R)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]ethyl]azanium (PubChem CID 6959669) has the molecular formula C24H29N2O4S+ and a molecular weight of 441.57 g/mol. Its IUPAC name is diethyl-[2-[(5R)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]ethyl]azanium.
| Compound Name | diethyl-[2-[(5R)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]ethyl]azanium |
|---|---|
| PubChem CID | 6959669 |
| Molecular Formula | C24H29N2O4S+ |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | diethyl-[2-[(5R)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]ethyl]azanium |
| SMILES | CC[NH+](CC)CCN1C(=O)C(=O)C(=C(O)c2ccc3c(c2)C[C@@H](C)O3)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C24H28N2O4S/c1-4-25(5-2)10-11-26-21(19-7-6-12-31-19)20(23(28)24(26)29)22(27)16-8-9-18-17(14-16)13-15(3)30-18/h6-9,12,14-15,21,27H,4-5,10-11,13H2,1-3H3/p+1/t15-,21+/m1/s1 |
| InChIKey | SPRLUCGGGGSTLU-VFNWGFHPSA-O |
| XLogP | 2.42 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|