C26H32N3O4+ — CID 6997107
diethyl-[3-[(4Z,5S)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]propyl]azanium (PubChem CID 6997107) has the molecular formula C26H32N3O4+ and a molecular weight of 450.56 g/mol. Its IUPAC name is diethyl-[3-[(4Z,5S)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]propyl]azanium.
| Compound Name | diethyl-[3-[(4Z,5S)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]propyl]azanium |
|---|---|
| PubChem CID | 6997107 |
| Molecular Formula | C26H32N3O4+ |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | diethyl-[3-[(4Z,5S)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]propyl]azanium |
| SMILES | CC[NH+](CC)CCCN1C(=O)C(=O)/C(=C(\O)c2ccc3c(c2)C[C@H](C)O3)[C@@H]1c1ccncc1 |
| InChI | InChI=1S/C26H31N3O4/c1-4-28(5-2)13-6-14-29-23(18-9-11-27-12-10-18)22(25(31)26(29)32)24(30)19-7-8-21-20(16-19)15-17(3)33-21/h7-12,16-17,23,30H,4-6,13-15H2,1-3H3/p+1/b24-22-/t17-,23-/m0/s1 |
| InChIKey | VCQOOMXHHAWUJK-QWGTWGDHSA-O |
| XLogP | 2.14 |
| TPSA | 84.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|