C21H24NO6S- — CID 6981486
(1R,2S,3R,4S)-3-[(3-ethoxycarbonyl-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyran-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 6981486) has the molecular formula C21H24NO6S- and a molecular weight of 418.49 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-[(3-ethoxycarbonyl-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyran-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1R,2S,3R,4S)-3-[(3-ethoxycarbonyl-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyran-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 6981486 |
| Molecular Formula | C21H24NO6S- |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (1R,2S,3R,4S)-3-[(3-ethoxycarbonyl-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyran-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)[C@H]2[C@@H](C(=O)[O-])[C@H]3C=C[C@@H]2C3)sc2c1CC(C)(C)OC2 |
| InChI | InChI=1S/C21H25NO6S/c1-4-27-20(26)16-12-8-21(2,3)28-9-13(12)29-18(16)22-17(23)14-10-5-6-11(7-10)15(14)19(24)25/h5-6,10-11,14-15H,4,7-9H2,1-3H3,(H,22,23)(H,24,25)/p-1/t10-,11+,14-,15+/m1/s1 |
| InChIKey | BPJBQXFMSHWXBY-BVIHXZOGSA-M |
| XLogP | 1.90 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|