C24H30NO5S- — CID 18390275
(1S,2S,3S,4S)-3-[[(6R)-6-tert-butyl-3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 18390275) has the molecular formula C24H30NO5S- and a molecular weight of 444.57 g/mol. Its IUPAC name is (1S,2S,3S,4S)-3-[[(6R)-6-tert-butyl-3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1S,2S,3S,4S)-3-[[(6R)-6-tert-butyl-3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 18390275 |
| Molecular Formula | C24H30NO5S- |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | (1S,2S,3S,4S)-3-[[(6R)-6-tert-butyl-3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)[C@@H]2[C@@H](C(=O)[O-])[C@@H]3C=C[C@@H]2C3)sc2c1CC[C@@H](C(C)(C)C)C2 |
| InChI | InChI=1S/C24H31NO5S/c1-5-30-23(29)19-15-9-8-14(24(2,3)4)11-16(15)31-21(19)25-20(26)17-12-6-7-13(10-12)18(17)22(27)28/h6-7,12-14,17-18H,5,8-11H2,1-4H3,(H,25,26)(H,27,28)/p-1/t12-,13-,14-,17+,18+/m1/s1 |
| InChIKey | CRXDHJKXZWBNDQ-QVXTZCDOSA-M |
| XLogP | 3.20 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_C(7)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|