C24H33NO5S — CID 124724752
(1S,2R,3R,4S)-3-[[(6R)-6-tert-butyl-3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 124724752) has the molecular formula C24H33NO5S and a molecular weight of 447.60 g/mol. Its IUPAC name is (1S,2R,3R,4S)-3-[[(6R)-6-tert-butyl-3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,2R,3R,4S)-3-[[(6R)-6-tert-butyl-3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 124724752 |
| Molecular Formula | C24H33NO5S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | (1S,2R,3R,4S)-3-[[(6R)-6-tert-butyl-3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CCOC(=O)c1c(NC(=O)[C@@H]2[C@H]3CC[C@@H](C3)[C@H]2C(=O)O)sc2c1CC[C@@H](C(C)(C)C)C2 |
| InChI | InChI=1S/C24H33NO5S/c1-5-30-23(29)19-15-9-8-14(24(2,3)4)11-16(15)31-21(19)25-20(26)17-12-6-7-13(10-12)18(17)22(27)28/h12-14,17-18H,5-11H2,1-4H3,(H,25,26)(H,27,28)/t12-,13-,14+,17+,18+/m0/s1 |
| InChIKey | ZSQKXDMCMBONPL-OXQIDUKASA-N |
| XLogP | 4.76 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_C(7)', 'substructure': 'N/A'} |
|---|