C22H16BrN2O6S- — CID 6981831
2-[[3-[(4-acetylphenyl)sulfamoyl]-4-bromobenzoyl]amino]benzoate (PubChem CID 6981831) has the molecular formula C22H16BrN2O6S- and a molecular weight of 516.35 g/mol. Its IUPAC name is 2-[[3-[(4-acetylphenyl)sulfamoyl]-4-bromobenzoyl]amino]benzoate.
| Compound Name | 2-[[3-[(4-acetylphenyl)sulfamoyl]-4-bromobenzoyl]amino]benzoate |
|---|---|
| PubChem CID | 6981831 |
| Molecular Formula | C22H16BrN2O6S- |
| Molecular Weight | 516.35 g/mol |
| Exact Mass | 514.99 |
| IUPAC Name | 2-[[3-[(4-acetylphenyl)sulfamoyl]-4-bromobenzoyl]amino]benzoate |
| SMILES | CC(=O)c1ccc(NS(=O)(=O)c2cc(C(=O)Nc3ccccc3C(=O)[O-])ccc2Br)cc1 |
| InChI | InChI=1S/C22H17BrN2O6S/c1-13(26)14-6-9-16(10-7-14)25-32(30,31)20-12-15(8-11-18(20)23)21(27)24-19-5-3-2-4-17(19)22(28)29/h2-12,25H,1H3,(H,24,27)(H,28,29)/p-1 |
| InChIKey | TZRSMEIHUYUZPB-UHFFFAOYSA-M |
| XLogP | 3.07 |
| TPSA | 132.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |