C25H31NO5 — CID 6982031
[(2R)-oxolan-2-yl]methyl (4R,4aR)-4-(4-methoxyphenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 6982031) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl (4R,4aR)-4-(4-methoxyphenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | [(2R)-oxolan-2-yl]methyl (4R,4aR)-4-(4-methoxyphenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 6982031 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl (4R,4aR)-4-(4-methoxyphenyl)-2,7,7-trimethyl-5-oxo-4,4a,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | COc1ccc([C@@H]2C(C(=O)OC[C@H]3CCCO3)=C(C)N=C3CC(C)(C)CC(=O)[C@@H]32)cc1 |
| InChI | InChI=1S/C25H31NO5/c1-15-21(24(28)31-14-18-6-5-11-30-18)22(16-7-9-17(29-4)10-8-16)23-19(26-15)12-25(2,3)13-20(23)27/h7-10,18,22-23H,5-6,11-14H2,1-4H3/t18-,22-,23-/m1/s1 |
| InChIKey | BEYPMAMNNWGCJX-SXSPYAJSSA-N |
| XLogP | 4.23 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |