About (3R)-3-piperidin-1-ium-1-yl-2,3-dihydrothiophene 1,1-dioxide
(3R)-3-piperidin-1-ium-1-yl-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 6983465) has the molecular formula C9H16NO2S+
and a molecular weight of 202.30 g/mol. Its IUPAC name is (3R)-3-piperidin-1-ium-1-yl-2,3-dihydrothiophene 1,1-dioxide.
Analyze (3R)-3-piperidin-1-ium-1-yl-2,3-dihydrothiophene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-piperidin-1-ium-1-yl-2,3-dihydrothiophene 1,1-dioxide?
The IUPAC name of (3R)-3-piperidin-1-ium-1-yl-2,3-dihydrothiophene 1,1-dioxide (CID 6983465) is (3R)-3-piperidin-1-ium-1-yl-2,3-dihydrothiophene 1,1-dioxide.
What is the SMILES notation for (3R)-3-piperidin-1-ium-1-yl-2,3-dihydrothiophene 1,1-dioxide?
The canonical SMILES for (3R)-3-piperidin-1-ium-1-yl-2,3-dihydrothiophene 1,1-dioxide is O=S1(=O)C=C[C@@H]([NH+]2CCCCC2)C1.
What is the InChIKey of (3R)-3-piperidin-1-ium-1-yl-2,3-dihydrothiophene 1,1-dioxide?
The InChIKey is PCBCJYQDNVXHSY-SECBINFHSA-O. The full InChI is InChI=1S/C9H15NO2S/c11-13(12)7-4-9(8-13)10-5-2-1-3-6-10/h4,7,9H,1-3,5-6,8H2/p+1/t9-/m1/s1.
What are the key properties of (3R)-3-piperidin-1-ium-1-yl-2,3-dihydrothiophene 1,1-dioxide?
(3R)-3-piperidin-1-ium-1-yl-2,3-dihydrothiophene 1,1-dioxide has a molecular weight of 202.30 g/mol, XLogP of -0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-piperidin-1-ium-1-yl-2,3-dihydrothiophene 1,1-dioxide is sourced from PubChem (CID 6983465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).