C9H15NO2S — CID 2831160
3-piperidin-1-yl-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 2831160) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is 3-piperidin-1-yl-2,3-dihydrothiophene 1,1-dioxide.
| Compound Name | 3-piperidin-1-yl-2,3-dihydrothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 2831160 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 3-piperidin-1-yl-2,3-dihydrothiophene 1,1-dioxide |
| SMILES | O=S1(=O)C=CC(N2CCCCC2)C1 |
| InChI | InChI=1S/C9H15NO2S/c11-13(12)7-4-9(8-13)10-5-2-1-3-6-10/h4,7,9H,1-3,5-6,8H2 |
| InChIKey | PCBCJYQDNVXHSY-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |