C17H34NO2S+ — CID 91805833
2-ethenyl-1-hexyl-1-(3-methylsulfonylpropyl)piperidin-1-ium (PubChem CID 91805833) has the molecular formula C17H34NO2S+ and a molecular weight of 316.53 g/mol. Its IUPAC name is 2-ethenyl-1-hexyl-1-(3-methylsulfonylpropyl)piperidin-1-ium.
| Compound Name | 2-ethenyl-1-hexyl-1-(3-methylsulfonylpropyl)piperidin-1-ium |
|---|---|
| PubChem CID | 91805833 |
| Molecular Formula | C17H34NO2S+ |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | 2-ethenyl-1-hexyl-1-(3-methylsulfonylpropyl)piperidin-1-ium |
| SMILES | C=CC1CCCC[N+]1(CCCCCC)CCCS(C)(=O)=O |
| InChI | InChI=1S/C17H34NO2S/c1-4-6-7-9-13-18(15-11-16-21(3,19)20)14-10-8-12-17(18)5-2/h5,17H,2,4,6-16H2,1,3H3/q+1 |
| InChIKey | NGMNCVPBZABAMP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|