C10H17NO2S — CID 1413792
(3S)-3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 1413792) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is (3S)-3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide.
| Compound Name | (3S)-3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 1413792 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | (3S)-3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide |
| SMILES | O=S1(=O)C=C[C@H](N2CCCCCC2)C1 |
| InChI | InChI=1S/C10H17NO2S/c12-14(13)8-5-10(9-14)11-6-3-1-2-4-7-11/h5,8,10H,1-4,6-7,9H2/t10-/m0/s1 |
| InChIKey | MTKJCHWTANGGGP-JTQLQIEISA-N |
| XLogP | 1.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |