C14H9ClN3O2S- — CID 6984441
4-[(6-chloro-1H-imidazo[4,5-b]pyridin-2-yl)sulfanylmethyl]benzoate (PubChem CID 6984441) has the molecular formula C14H9ClN3O2S- and a molecular weight of 318.77 g/mol. Its IUPAC name is 4-[(6-chloro-1H-imidazo[4,5-b]pyridin-2-yl)sulfanylmethyl]benzoate.
| Compound Name | 4-[(6-chloro-1H-imidazo[4,5-b]pyridin-2-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 6984441 |
| Molecular Formula | C14H9ClN3O2S- |
| Molecular Weight | 318.77 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 4-[(6-chloro-1H-imidazo[4,5-b]pyridin-2-yl)sulfanylmethyl]benzoate |
| SMILES | O=C([O-])c1ccc(CSc2nc3ncc(Cl)cc3[nH]2)cc1 |
| InChI | InChI=1S/C14H10ClN3O2S/c15-10-5-11-12(16-6-10)18-14(17-11)21-7-8-1-3-9(4-2-8)13(19)20/h1-6H,7H2,(H,19,20)(H,16,17,18)/p-1 |
| InChIKey | WXXIMCLAXDFFFJ-UHFFFAOYSA-M |
| XLogP | 2.27 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.77 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |