C15H23N4O+ — CID 6984824
2-[4-[[(2S)-2-hydroxypropyl]amino]quinazolin-2-yl]ethyl-dimethylazanium (PubChem CID 6984824) has the molecular formula C15H23N4O+ and a molecular weight of 275.38 g/mol. Its IUPAC name is 2-[4-[[(2S)-2-hydroxypropyl]amino]quinazolin-2-yl]ethyl-dimethylazanium.
| Compound Name | 2-[4-[[(2S)-2-hydroxypropyl]amino]quinazolin-2-yl]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 6984824 |
| Molecular Formula | C15H23N4O+ |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 2-[4-[[(2S)-2-hydroxypropyl]amino]quinazolin-2-yl]ethyl-dimethylazanium |
| SMILES | C[C@H](O)CNc1nc(CC[NH+](C)C)nc2ccccc12 |
| InChI | InChI=1S/C15H22N4O/c1-11(20)10-16-15-12-6-4-5-7-13(12)17-14(18-15)8-9-19(2)3/h4-7,11,20H,8-10H2,1-3H3,(H,16,17,18)/p+1/t11-/m0/s1 |
| InChIKey | ZINDSACAYOQXPC-NSHDSACASA-O |
| XLogP | 0.11 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |