C18H17N2O3- — CID 6985266
(2S)-2-[[4-(dimethylamino)phenyl]methyl]-3-oxo-1,2-dihydroindole-4-carboxylate (PubChem CID 6985266) has the molecular formula C18H17N2O3- and a molecular weight of 309.35 g/mol. Its IUPAC name is (2S)-2-[[4-(dimethylamino)phenyl]methyl]-3-oxo-1,2-dihydroindole-4-carboxylate.
| Compound Name | (2S)-2-[[4-(dimethylamino)phenyl]methyl]-3-oxo-1,2-dihydroindole-4-carboxylate |
|---|---|
| PubChem CID | 6985266 |
| Molecular Formula | C18H17N2O3- |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (2S)-2-[[4-(dimethylamino)phenyl]methyl]-3-oxo-1,2-dihydroindole-4-carboxylate |
| SMILES | CN(C)c1ccc(C[C@@H]2Nc3cccc(C(=O)[O-])c3C2=O)cc1 |
| InChI | InChI=1S/C18H18N2O3/c1-20(2)12-8-6-11(7-9-12)10-15-17(21)16-13(18(22)23)4-3-5-14(16)19-15/h3-9,15,19H,10H2,1-2H3,(H,22,23)/p-1/t15-/m0/s1 |
| InChIKey | WAOOYRLBLYAFQH-HNNXBMFYSA-M |
| XLogP | 1.34 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|