C21H24FNO — CID 6987392
(Z)-N-[(2-fluorophenyl)methoxy]-1-[(1S,2R)-2-(4-propan-2-ylphenyl)cyclopropyl]ethanimine (PubChem CID 6987392) has the molecular formula C21H24FNO and a molecular weight of 325.43 g/mol. Its IUPAC name is (Z)-N-[(2-fluorophenyl)methoxy]-1-[(1S,2R)-2-(4-propan-2-ylphenyl)cyclopropyl]ethanimine.
| Compound Name | (Z)-N-[(2-fluorophenyl)methoxy]-1-[(1S,2R)-2-(4-propan-2-ylphenyl)cyclopropyl]ethanimine |
|---|---|
| PubChem CID | 6987392 |
| Molecular Formula | C21H24FNO |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (Z)-N-[(2-fluorophenyl)methoxy]-1-[(1S,2R)-2-(4-propan-2-ylphenyl)cyclopropyl]ethanimine |
| SMILES | C/C(=N/OCc1ccccc1F)[C@H]1C[C@H]1c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C21H24FNO/c1-14(2)16-8-10-17(11-9-16)20-12-19(20)15(3)23-24-13-18-6-4-5-7-21(18)22/h4-11,14,19-20H,12-13H2,1-3H3/b23-15-/t19-,20+/m1/s1 |
| InChIKey | FDRSCKXBTVRVSF-KOEFRDAESA-N |
| XLogP | 5.65 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|