C16H22N3O3+ — CID 6987599
N-(2-cyano-4,5-dimethoxyphenyl)-2-piperidin-1-ium-1-ylacetamide (PubChem CID 6987599) has the molecular formula C16H22N3O3+ and a molecular weight of 304.37 g/mol. Its IUPAC name is N-(2-cyano-4,5-dimethoxyphenyl)-2-piperidin-1-ium-1-ylacetamide.
| Compound Name | N-(2-cyano-4,5-dimethoxyphenyl)-2-piperidin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 6987599 |
| Molecular Formula | C16H22N3O3+ |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | N-(2-cyano-4,5-dimethoxyphenyl)-2-piperidin-1-ium-1-ylacetamide |
| SMILES | COc1cc(C#N)c(NC(=O)C[NH+]2CCCCC2)cc1OC |
| InChI | InChI=1S/C16H21N3O3/c1-21-14-8-12(10-17)13(9-15(14)22-2)18-16(20)11-19-6-4-3-5-7-19/h8-9H,3-7,11H2,1-2H3,(H,18,20)/p+1 |
| InChIKey | OENBQEAAMUJGIB-UHFFFAOYSA-O |
| XLogP | 0.58 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |