C23H29N4O4+ — CID 7306323
N-(2-cyano-4,5-dimethoxyphenyl)-2-[(3S)-4-(4-methoxyphenyl)-3-methylpiperazin-1-ium-1-yl]acetamide (PubChem CID 7306323) has the molecular formula C23H29N4O4+ and a molecular weight of 425.51 g/mol. Its IUPAC name is N-(2-cyano-4,5-dimethoxyphenyl)-2-[(3S)-4-(4-methoxyphenyl)-3-methylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-cyano-4,5-dimethoxyphenyl)-2-[(3S)-4-(4-methoxyphenyl)-3-methylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 7306323 |
| Molecular Formula | C23H29N4O4+ |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | N-(2-cyano-4,5-dimethoxyphenyl)-2-[(3S)-4-(4-methoxyphenyl)-3-methylpiperazin-1-ium-1-yl]acetamide |
| SMILES | COc1ccc(N2CC[NH+](CC(=O)Nc3cc(OC)c(OC)cc3C#N)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C23H28N4O4/c1-16-14-26(9-10-27(16)18-5-7-19(29-2)8-6-18)15-23(28)25-20-12-22(31-4)21(30-3)11-17(20)13-24/h5-8,11-12,16H,9-10,14-15H2,1-4H3,(H,25,28)/p+1/t16-/m0/s1 |
| InChIKey | BURCFVZBMZMREF-INIZCTEOSA-O |
| XLogP | 1.32 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|