C8H12O — CID 6994296
(1S,4Z,8R)-9-oxabicyclo[6.1.0]non-4-ene (PubChem CID 6994296) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is (1S,4Z,8R)-9-oxabicyclo[6.1.0]non-4-ene.
| Compound Name | (1S,4Z,8R)-9-oxabicyclo[6.1.0]non-4-ene |
|---|---|
| PubChem CID | 6994296 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (1S,4Z,8R)-9-oxabicyclo[6.1.0]non-4-ene |
| SMILES | C1=C\CC[C@H]2O[C@H]2CC/1 |
| InChI | InChI=1S/C8H12O/c1-2-4-6-8-7(9-8)5-3-1/h1-2,7-8H,3-6H2/b2-1-/t7-,8+ |
| InChIKey | YWFPXWMSGJXUFS-VMPVEFHESA-N |
| XLogP | 1.88 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|