C10H15NO6 — CID 6995910
2-[(3-ethoxy-2-ethoxycarbonyl-3-oxopropylidene)amino]acetic acid (PubChem CID 6995910) has the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. Its IUPAC name is 2-[(3-ethoxy-2-ethoxycarbonyl-3-oxopropylidene)amino]acetic acid.
| Compound Name | 2-[(3-ethoxy-2-ethoxycarbonyl-3-oxopropylidene)amino]acetic acid |
|---|---|
| PubChem CID | 6995910 |
| Molecular Formula | C10H15NO6 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2-[(3-ethoxy-2-ethoxycarbonyl-3-oxopropylidene)amino]acetic acid |
| SMILES | CCOC(=O)C(/C=N/CC(=O)O)C(=O)OCC |
| InChI | InChI=1S/C10H15NO6/c1-3-16-9(14)7(10(15)17-4-2)5-11-6-8(12)13/h5,7H,3-4,6H2,1-2H3,(H,12,13)/b11-5+ |
| InChIKey | PFHSNWRAZXBODS-VZUCSPMQSA-N |
| XLogP | -0.12 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|