C11H16NO7- — CID 6995913
(2R)-2-[(3-ethoxy-2-ethoxycarbonyl-3-oxopropylidene)amino]-3-hydroxypropanoate (PubChem CID 6995913) has the molecular formula C11H16NO7- and a molecular weight of 274.25 g/mol. Its IUPAC name is (2R)-2-[(3-ethoxy-2-ethoxycarbonyl-3-oxopropylidene)amino]-3-hydroxypropanoate.
| Compound Name | (2R)-2-[(3-ethoxy-2-ethoxycarbonyl-3-oxopropylidene)amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 6995913 |
| Molecular Formula | C11H16NO7- |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | (2R)-2-[(3-ethoxy-2-ethoxycarbonyl-3-oxopropylidene)amino]-3-hydroxypropanoate |
| SMILES | CCOC(=O)C(/C=N/[C@H](CO)C(=O)[O-])C(=O)OCC |
| InChI | InChI=1S/C11H17NO7/c1-3-18-10(16)7(11(17)19-4-2)5-12-8(6-13)9(14)15/h5,7-8,13H,3-4,6H2,1-2H3,(H,14,15)/p-1/b12-5+/t8-/m1/s1 |
| InChIKey | IYZVKMOCHZKETJ-HRRMIQFSSA-M |
| XLogP | -2.09 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|