C23H24N4O2S — CID 6995959
(2R)-N-(cinnamylideneamino)-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]propanamide (PubChem CID 6995959) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is (2R)-N-(cinnamylideneamino)-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]propanamide.
| Compound Name | (2R)-N-(cinnamylideneamino)-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]propanamide |
|---|---|
| PubChem CID | 6995959 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (2R)-N-(cinnamylideneamino)-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]propanamide |
| SMILES | C[C@H]1CCc2c(sc3ncn([C@H](C)C(=O)NN=CC=Cc4ccccc4)c(=O)c23)C1 |
| InChI | InChI=1S/C23H24N4O2S/c1-15-10-11-18-19(13-15)30-22-20(18)23(29)27(14-24-22)16(2)21(28)26-25-12-6-9-17-7-4-3-5-8-17/h3-9,12,14-16H,10-11,13H2,1-2H3,(H,26,28)/t15-,16+/m0/s1 |
| InChIKey | HEEWGDIJMRSASK-JKSUJKDBSA-N |
| XLogP | 3.96 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|