C16H16BrNO3 — CID 6997895
4-[(Z)-2-(4-bromophenyl)-1-(hydroxyamino)ethenyl]-6-ethylbenzene-1,3-diol (PubChem CID 6997895) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is 4-[(Z)-2-(4-bromophenyl)-1-(hydroxyamino)ethenyl]-6-ethylbenzene-1,3-diol.
| Compound Name | 4-[(Z)-2-(4-bromophenyl)-1-(hydroxyamino)ethenyl]-6-ethylbenzene-1,3-diol |
|---|---|
| PubChem CID | 6997895 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 4-[(Z)-2-(4-bromophenyl)-1-(hydroxyamino)ethenyl]-6-ethylbenzene-1,3-diol |
| SMILES | CCc1cc(/C(=C/c2ccc(Br)cc2)NO)c(O)cc1O |
| InChI | InChI=1S/C16H16BrNO3/c1-2-11-8-13(16(20)9-15(11)19)14(18-21)7-10-3-5-12(17)6-4-10/h3-9,18-21H,2H2,1H3/b14-7- |
| InChIKey | YMZUXFGNUGMAKP-AUWJEWJLSA-N |
| XLogP | 3.90 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|